C21H41NO3 — CID 142247805
3-hydroxy-4,4,6,8,12-pentamethyl-15-(methylamino)-5-oxopentadecanal (PubChem CID 142247805) has the molecular formula C21H41NO3 and a molecular weight of 355.56 g/mol. Its IUPAC name is 3-hydroxy-4,4,6,8,12-pentamethyl-15-(methylamino)-5-oxopentadecanal.
| Compound Name | 3-hydroxy-4,4,6,8,12-pentamethyl-15-(methylamino)-5-oxopentadecanal |
|---|---|
| PubChem CID | 142247805 |
| Molecular Formula | C21H41NO3 |
| Molecular Weight | 355.56 g/mol |
| Exact Mass | 355.31 |
| IUPAC Name | 3-hydroxy-4,4,6,8,12-pentamethyl-15-(methylamino)-5-oxopentadecanal |
| SMILES | CNCCCC(C)CCCC(C)CC(C)C(=O)C(C)(C)C(O)CC=O |
| InChI | InChI=1S/C21H41NO3/c1-16(11-8-13-22-6)9-7-10-17(2)15-18(3)20(25)21(4,5)19(24)12-14-23/h14,16-19,22,24H,7-13,15H2,1-6H3 |
| InChIKey | YYVCXTOCZZXDLT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.56 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|