C34H58N2O3 — CID 142247878
(13Z,15S)-4-hydroxy-5,5,7,9,15-pentamethyl-1-azacyclohexadec-13-ene-2,6-dione;(Z)-N-[(2Z,4Z)-6-methylhepta-2,4-dien-4-yl]hex-4-en-2-imine (PubChem CID 142247878) has the molecular formula C34H58N2O3 and a molecular weight of 542.85 g/mol. Its IUPAC name is (13Z,15S)-4-hydroxy-5,5,7,9,15-pentamethyl-1-azacyclohexadec-13-ene-2,6-dione;(Z)-N-[(2Z,4Z)-6-methylhepta-2,4-dien-4-yl]hex-4-en-2-imine.
| Compound Name | (13Z,15S)-4-hydroxy-5,5,7,9,15-pentamethyl-1-azacyclohexadec-13-ene-2,6-dione;(Z)-N-[(2Z,4Z)-6-methylhepta-2,4-dien-4-yl]hex-4-en-2-imine |
|---|---|
| PubChem CID | 142247878 |
| Molecular Formula | C34H58N2O3 |
| Molecular Weight | 542.85 g/mol |
| Exact Mass | 542.44 |
| IUPAC Name | (13Z,15S)-4-hydroxy-5,5,7,9,15-pentamethyl-1-azacyclohexadec-13-ene-2,6-dione;(Z)-N-[(2Z,4Z)-6-methylhepta-2,4-dien-4-yl]hex-4-en-2-imine |
| SMILES | C/C=C\C/C(C)=N/C(/C=C\C)=C\C(C)C.CC1CCC/C=C\[C@H](C)CNC(=O)CC(O)C(C)(C)C(=O)C(C)C1 |
| InChI | InChI=1S/C20H35NO3.C14H23N/c1-14-9-7-6-8-10-15(2)13-21-18(23)12-17(22)20(4,5)19(24)16(3)11-14;1-6-8-10-13(5)15-14(9-7-2)11-12(3)4/h8,10,14-17,22H,6-7,9,11-13H2,1-5H3,(H,21,23);6-9,11-12H,10H2,1-5H3/b10-8-;8-6-,9-7-,14-11-,15-13+/t14?,15-,16?,17?;/m0./s1 |
| InChIKey | ALORACVQBUZRBT-TVWOLHSFSA-N |
| XLogP | 8.02 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.85 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|