C28H48N2O3 — CID 142247884
(15S)-4-hydroxy-5,5,7,9,15-pentamethyl-azacyclohexadecane-2,6-dione;2-methyl-5-[(Z)-prop-1-enyl]-3H-pyrrole (PubChem CID 142247884) has the molecular formula C28H48N2O3 and a molecular weight of 460.70 g/mol. Its IUPAC name is (15S)-4-hydroxy-5,5,7,9,15-pentamethyl-azacyclohexadecane-2,6-dione;2-methyl-5-[(Z)-prop-1-enyl]-3H-pyrrole.
| Compound Name | (15S)-4-hydroxy-5,5,7,9,15-pentamethyl-azacyclohexadecane-2,6-dione;2-methyl-5-[(Z)-prop-1-enyl]-3H-pyrrole |
|---|---|
| PubChem CID | 142247884 |
| Molecular Formula | C28H48N2O3 |
| Molecular Weight | 460.70 g/mol |
| Exact Mass | 460.37 |
| IUPAC Name | (15S)-4-hydroxy-5,5,7,9,15-pentamethyl-azacyclohexadecane-2,6-dione;2-methyl-5-[(Z)-prop-1-enyl]-3H-pyrrole |
| SMILES | C/C=C\C1=CCC(C)=N1.CC1CCCCC[C@H](C)CNC(=O)CC(O)C(C)(C)C(=O)C(C)C1 |
| InChI | InChI=1S/C20H37NO3.C8H11N/c1-14-9-7-6-8-10-15(2)13-21-18(23)12-17(22)20(4,5)19(24)16(3)11-14;1-3-4-8-6-5-7(2)9-8/h14-17,22H,6-13H2,1-5H3,(H,21,23);3-4,6H,5H2,1-2H3/b;4-3-/t14?,15-,16?,17?;/m0./s1 |
| InChIKey | BQVYKMHLTJXPJO-YMJRYHIISA-N |
| XLogP | 6.02 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.70 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |