C21H30F3N3O — CID 142248619
N-[7-[ethyl-[(1-methylpiperidin-4-yl)methyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 142248619) has the molecular formula C21H30F3N3O and a molecular weight of 397.49 g/mol. Its IUPAC name is N-[7-[ethyl-[(1-methylpiperidin-4-yl)methyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[7-[ethyl-[(1-methylpiperidin-4-yl)methyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 142248619 |
| Molecular Formula | C21H30F3N3O |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | N-[7-[ethyl-[(1-methylpiperidin-4-yl)methyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | CCN(CC1CCN(C)CC1)C1CCc2ccc(NC(=O)C(F)(F)F)cc2C1 |
| InChI | InChI=1S/C21H30F3N3O/c1-3-27(14-15-8-10-26(2)11-9-15)19-7-5-16-4-6-18(12-17(16)13-19)25-20(28)21(22,23)24/h4,6,12,15,19H,3,5,7-11,13-14H2,1-2H3,(H,25,28) |
| InChIKey | RARPKQMCWKQPAM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |