C20H22ClF3N4OS — CID 142249432
4-[(2Z,4E)-2-tert-butyl-4-chloro-5-methylhepta-2,4,6-trienyl]-3-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-1H-1,2,4-triazol-5-one (PubChem CID 142249432) has the molecular formula C20H22ClF3N4OS and a molecular weight of 458.94 g/mol. Its IUPAC name is 4-[(2Z,4E)-2-tert-butyl-4-chloro-5-methylhepta-2,4,6-trienyl]-3-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-1H-1,2,4-triazol-5-one.
| Compound Name | 4-[(2Z,4E)-2-tert-butyl-4-chloro-5-methylhepta-2,4,6-trienyl]-3-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 142249432 |
| Molecular Formula | C20H22ClF3N4OS |
| Molecular Weight | 458.94 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 4-[(2Z,4E)-2-tert-butyl-4-chloro-5-methylhepta-2,4,6-trienyl]-3-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-1H-1,2,4-triazol-5-one |
| SMILES | C=C/C(C)=C(Cl)\C=C(/Cn1c(Sc2ccc(C(F)(F)F)cn2)n[nH]c1=O)C(C)(C)C |
| InChI | InChI=1S/C20H22ClF3N4OS/c1-6-12(2)15(21)9-14(19(3,4)5)11-28-17(29)26-27-18(28)30-16-8-7-13(10-25-16)20(22,23)24/h6-10H,1,11H2,2-5H3,(H,26,29)/b14-9+,15-12+ |
| InChIKey | PGMPRWAZYIWJMM-WKDANBKTSA-N |
| XLogP | 5.81 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.94 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|