C14H18F3N3OS — CID 142249595
ethane;4-[4-propyl-2-(trifluoromethyl)phenyl]-5-sulfanylidene-1,2,4-triazolidin-3-one (PubChem CID 142249595) has the molecular formula C14H18F3N3OS and a molecular weight of 333.38 g/mol. Its IUPAC name is ethane;4-[4-propyl-2-(trifluoromethyl)phenyl]-5-sulfanylidene-1,2,4-triazolidin-3-one.
| Compound Name | ethane;4-[4-propyl-2-(trifluoromethyl)phenyl]-5-sulfanylidene-1,2,4-triazolidin-3-one |
|---|---|
| PubChem CID | 142249595 |
| Molecular Formula | C14H18F3N3OS |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | ethane;4-[4-propyl-2-(trifluoromethyl)phenyl]-5-sulfanylidene-1,2,4-triazolidin-3-one |
| SMILES | CC.CCCc1ccc(-n2c(=O)[nH][nH]c2=S)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H12F3N3OS.C2H6/c1-2-3-7-4-5-9(8(6-7)12(13,14)15)18-10(19)16-17-11(18)20;1-2/h4-6H,2-3H2,1H3,(H,16,19)(H,17,20);1-2H3 |
| InChIKey | ADZZYPFWBXCIPP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 53.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|