About 1-[(3,5-difluorophenyl)methyl]-4-[3-(4-methoxyphenyl)propyl]-4-methylimidazolidin-2-one
1-[(3,5-difluorophenyl)methyl]-4-[3-(4-methoxyphenyl)propyl]-4-methylimidazolidin-2-one (PubChem CID 142249659) has the molecular formula C21H24F2N2O2
and a molecular weight of 374.43 g/mol. Its IUPAC name is 1-[(3,5-difluorophenyl)methyl]-4-[3-(4-methoxyphenyl)propyl]-4-methylimidazolidin-2-one.
Molecular Properties
| Compound Name | 1-[(3,5-difluorophenyl)methyl]-4-[3-(4-methoxyphenyl)propyl]-4-methylimidazolidin-2-one |
| PubChem CID | 142249659 |
| Molecular Formula | C21H24F2N2O2 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 1-[(3,5-difluorophenyl)methyl]-4-[3-(4-methoxyphenyl)propyl]-4-methylimidazolidin-2-one |
| SMILES | COc1ccc(CCCC2(C)CN(Cc3cc(F)cc(F)c3)C(=O)N2)cc1 |
| InChI | InChI=1S/C21H24F2N2O2/c1-21(9-3-4-15-5-7-19(27-2)8-6-15)14-25(20(26)24-21)13-16-10-17(22)12-18(23)11-16/h5-8,10-12H,3-4,9,13-14H2,1-2H3,(H,24,26) |
| InChIKey | KRULNUHOXTYXCL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(3,5-difluorophenyl)methyl]-4-[3-(4-methoxyphenyl)propyl]-4-methylimidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,5-difluorophenyl)methyl]-4-[3-(4-methoxyphenyl)propyl]-4-methylimidazolidin-2-one?
The IUPAC name of 1-[(3,5-difluorophenyl)methyl]-4-[3-(4-methoxyphenyl)propyl]-4-methylimidazolidin-2-one (CID 142249659) is 1-[(3,5-difluorophenyl)methyl]-4-[3-(4-methoxyphenyl)propyl]-4-methylimidazolidin-2-one.
What is the SMILES notation for 1-[(3,5-difluorophenyl)methyl]-4-[3-(4-methoxyphenyl)propyl]-4-methylimidazolidin-2-one?
The canonical SMILES for 1-[(3,5-difluorophenyl)methyl]-4-[3-(4-methoxyphenyl)propyl]-4-methylimidazolidin-2-one is COc1ccc(CCCC2(C)CN(Cc3cc(F)cc(F)c3)C(=O)N2)cc1.
What is the InChIKey of 1-[(3,5-difluorophenyl)methyl]-4-[3-(4-methoxyphenyl)propyl]-4-methylimidazolidin-2-one?
The InChIKey is KRULNUHOXTYXCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24F2N2O2/c1-21(9-3-4-15-5-7-19(27-2)8-6-15)14-25(20(26)24-21)13-16-10-17(22)12-18(23)11-16/h5-8,10-12H,3-4,9,13-14H2,1-2H3,(H,24,26).
What are the key properties of 1-[(3,5-difluorophenyl)methyl]-4-[3-(4-methoxyphenyl)propyl]-4-methylimidazolidin-2-one?
1-[(3,5-difluorophenyl)methyl]-4-[3-(4-methoxyphenyl)propyl]-4-methylimidazolidin-2-one has a molecular weight of 374.43 g/mol, XLogP of 4.28, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-difluorophenyl)methyl]-4-[3-(4-methoxyphenyl)propyl]-4-methylimidazolidin-2-one is sourced from PubChem (CID 142249659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).