About 4-butyl-1-[(Z,2E)-2-ethylidenepent-3-enyl]piperidine;ethane
4-butyl-1-[(Z,2E)-2-ethylidenepent-3-enyl]piperidine;ethane (PubChem CID 142250353) has the molecular formula C18H35N
and a molecular weight of 265.49 g/mol. Its IUPAC name is 4-butyl-1-[(Z,2E)-2-ethylidenepent-3-enyl]piperidine;ethane.
Molecular Properties
| Compound Name | 4-butyl-1-[(Z,2E)-2-ethylidenepent-3-enyl]piperidine;ethane |
| PubChem CID | 142250353 |
| Molecular Formula | C18H35N |
| Molecular Weight | 265.49 g/mol |
| Exact Mass | 265.28 |
| IUPAC Name | 4-butyl-1-[(Z,2E)-2-ethylidenepent-3-enyl]piperidine;ethane |
| SMILES | C/C=C\C(=C/C)CN1CCC(CCCC)CC1.CC |
| InChI | InChI=1S/C16H29N.C2H6/c1-4-7-9-16-10-12-17(13-11-16)14-15(6-3)8-5-2;1-2/h5-6,8,16H,4,7,9-14H2,1-3H3;1-2H3/b8-5-,15-6+; |
| InChIKey | AJUPCPWTIDMPCH-SXKIWYRESA-N |
| XLogP | 5.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 265.49 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-butyl-1-[(Z,2E)-2-ethylidenepent-3-enyl]piperidine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-1-[(Z,2E)-2-ethylidenepent-3-enyl]piperidine;ethane?
The IUPAC name of 4-butyl-1-[(Z,2E)-2-ethylidenepent-3-enyl]piperidine;ethane (CID 142250353) is 4-butyl-1-[(Z,2E)-2-ethylidenepent-3-enyl]piperidine;ethane.
What is the SMILES notation for 4-butyl-1-[(Z,2E)-2-ethylidenepent-3-enyl]piperidine;ethane?
The canonical SMILES for 4-butyl-1-[(Z,2E)-2-ethylidenepent-3-enyl]piperidine;ethane is C/C=C\C(=C/C)CN1CCC(CCCC)CC1.CC.
What is the InChIKey of 4-butyl-1-[(Z,2E)-2-ethylidenepent-3-enyl]piperidine;ethane?
The InChIKey is AJUPCPWTIDMPCH-SXKIWYRESA-N. The full InChI is InChI=1S/C16H29N.C2H6/c1-4-7-9-16-10-12-17(13-11-16)14-15(6-3)8-5-2;1-2/h5-6,8,16H,4,7,9-14H2,1-3H3;1-2H3/b8-5-,15-6+;.
What are the key properties of 4-butyl-1-[(Z,2E)-2-ethylidenepent-3-enyl]piperidine;ethane?
4-butyl-1-[(Z,2E)-2-ethylidenepent-3-enyl]piperidine;ethane has a molecular weight of 265.49 g/mol, XLogP of 5.44, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-1-[(Z,2E)-2-ethylidenepent-3-enyl]piperidine;ethane is sourced from PubChem (CID 142250353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).