C12H23N — CID 142250465
ethane;(2E)-2-ethenyl-N,N,3-trimethylpenta-2,4-dien-1-amine (PubChem CID 142250465) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is ethane;(2E)-2-ethenyl-N,N,3-trimethylpenta-2,4-dien-1-amine.
| Compound Name | ethane;(2E)-2-ethenyl-N,N,3-trimethylpenta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 142250465 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | ethane;(2E)-2-ethenyl-N,N,3-trimethylpenta-2,4-dien-1-amine |
| SMILES | C=C/C(C)=C(\C=C)CN(C)C.CC |
| InChI | InChI=1S/C10H17N.C2H6/c1-6-9(3)10(7-2)8-11(4)5;1-2/h6-7H,1-2,8H2,3-5H3;1-2H3/b10-9+; |
| InChIKey | OGRZPTPRZMEVDP-RRABGKBLSA-N |
| XLogP | 3.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|