C18H33NO — CID 142251017
ethane;(3S)-2-ethyl-3-(3-methoxyphenyl)-N-methylhexan-1-amine (PubChem CID 142251017) has the molecular formula C18H33NO and a molecular weight of 279.47 g/mol. Its IUPAC name is ethane;(3S)-2-ethyl-3-(3-methoxyphenyl)-N-methylhexan-1-amine.
| Compound Name | ethane;(3S)-2-ethyl-3-(3-methoxyphenyl)-N-methylhexan-1-amine |
|---|---|
| PubChem CID | 142251017 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | ethane;(3S)-2-ethyl-3-(3-methoxyphenyl)-N-methylhexan-1-amine |
| SMILES | CC.CCC[C@H](c1cccc(OC)c1)C(CC)CNC |
| InChI | InChI=1S/C16H27NO.C2H6/c1-5-8-16(13(6-2)12-17-3)14-9-7-10-15(11-14)18-4;1-2/h7,9-11,13,16-17H,5-6,8,12H2,1-4H3;1-2H3/t13?,16-;/m0./s1 |
| InChIKey | IJVNAUJKIDXWLD-GPPWNDLUSA-N |
| XLogP | 4.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |