About cyclohepta-1,3,6-trien-1-ol;3-(methylaminomethyl)heptan-4-ol
cyclohepta-1,3,6-trien-1-ol;3-(methylaminomethyl)heptan-4-ol (PubChem CID 142251035) has the molecular formula C16H29NO2
and a molecular weight of 267.41 g/mol. Its IUPAC name is cyclohepta-1,3,6-trien-1-ol;3-(methylaminomethyl)heptan-4-ol.
Molecular Properties
| Compound Name | cyclohepta-1,3,6-trien-1-ol;3-(methylaminomethyl)heptan-4-ol |
| PubChem CID | 142251035 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | cyclohepta-1,3,6-trien-1-ol;3-(methylaminomethyl)heptan-4-ol |
| SMILES | CCCC(O)C(CC)CNC.OC1=CC=CCC=C1 |
| InChI | InChI=1S/C9H21NO.C7H8O/c1-4-6-9(11)8(5-2)7-10-3;8-7-5-3-1-2-4-6-7/h8-11H,4-7H2,1-3H3;1,3-6,8H,2H2 |
| InChIKey | NIYCJPLFCNGZMN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohepta-1,3,6-trien-1-ol;3-(methylaminomethyl)heptan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohepta-1,3,6-trien-1-ol;3-(methylaminomethyl)heptan-4-ol?
The IUPAC name of cyclohepta-1,3,6-trien-1-ol;3-(methylaminomethyl)heptan-4-ol (CID 142251035) is cyclohepta-1,3,6-trien-1-ol;3-(methylaminomethyl)heptan-4-ol.
What is the SMILES notation for cyclohepta-1,3,6-trien-1-ol;3-(methylaminomethyl)heptan-4-ol?
The canonical SMILES for cyclohepta-1,3,6-trien-1-ol;3-(methylaminomethyl)heptan-4-ol is CCCC(O)C(CC)CNC.OC1=CC=CCC=C1.
What is the InChIKey of cyclohepta-1,3,6-trien-1-ol;3-(methylaminomethyl)heptan-4-ol?
The InChIKey is NIYCJPLFCNGZMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21NO.C7H8O/c1-4-6-9(11)8(5-2)7-10-3;8-7-5-3-1-2-4-6-7/h8-11H,4-7H2,1-3H3;1,3-6,8H,2H2.
What are the key properties of cyclohepta-1,3,6-trien-1-ol;3-(methylaminomethyl)heptan-4-ol?
cyclohepta-1,3,6-trien-1-ol;3-(methylaminomethyl)heptan-4-ol has a molecular weight of 267.41 g/mol, XLogP of 3.34, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohepta-1,3,6-trien-1-ol;3-(methylaminomethyl)heptan-4-ol is sourced from PubChem (CID 142251035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).