C16H29NO — CID 142251045
(4Z,5E)-2-ethyl-4-ethylidene-6-methoxy-3-propylocta-5,7-dien-1-amine (PubChem CID 142251045) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is (4Z,5E)-2-ethyl-4-ethylidene-6-methoxy-3-propylocta-5,7-dien-1-amine.
| Compound Name | (4Z,5E)-2-ethyl-4-ethylidene-6-methoxy-3-propylocta-5,7-dien-1-amine |
|---|---|
| PubChem CID | 142251045 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | (4Z,5E)-2-ethyl-4-ethylidene-6-methoxy-3-propylocta-5,7-dien-1-amine |
| SMILES | C=C/C(=C\C(=C/C)C(CCC)C(CC)CN)OC |
| InChI | InChI=1S/C16H29NO/c1-6-10-16(14(8-3)12-17)13(7-2)11-15(9-4)18-5/h7,9,11,14,16H,4,6,8,10,12,17H2,1-3,5H3/b13-7+,15-11+ |
| InChIKey | XULUBLARLDKDHZ-SWZCAMMWSA-N |
| XLogP | 4.05 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|