C16H29NO — CID 142251065
(3R,4R,5E,6Z)-3-[(dimethylamino)methyl]-4-ethyl-5-ethylidenenona-6,8-dien-4-ol (PubChem CID 142251065) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is (3R,4R,5E,6Z)-3-[(dimethylamino)methyl]-4-ethyl-5-ethylidenenona-6,8-dien-4-ol.
| Compound Name | (3R,4R,5E,6Z)-3-[(dimethylamino)methyl]-4-ethyl-5-ethylidenenona-6,8-dien-4-ol |
|---|---|
| PubChem CID | 142251065 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | (3R,4R,5E,6Z)-3-[(dimethylamino)methyl]-4-ethyl-5-ethylidenenona-6,8-dien-4-ol |
| SMILES | C=C/C=C\C(=C/C)[C@@](O)(CC)[C@H](CC)CN(C)C |
| InChI | InChI=1S/C16H29NO/c1-7-11-12-14(8-2)16(18,10-4)15(9-3)13-17(5)6/h7-8,11-12,15,18H,1,9-10,13H2,2-6H3/b12-11-,14-8+/t15-,16+/m1/s1 |
| InChIKey | FGVLCAWFJXCERE-YUBRPDHZSA-N |
| XLogP | 3.40 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|