C28H38ClFN4O2 — CID 142251214
3-(3-chloro-4-fluorophenyl)-1-[4-[(2Z,4E)-5-cyano-6-methylhepta-2,4-dienyl]cyclohexyl]-1-[2-[(3S)-3-hydroxypyrrolidin-1-yl]ethyl]urea (PubChem CID 142251214) has the molecular formula C28H38ClFN4O2 and a molecular weight of 517.09 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenyl)-1-[4-[(2Z,4E)-5-cyano-6-methylhepta-2,4-dienyl]cyclohexyl]-1-[2-[(3S)-3-hydroxypyrrolidin-1-yl]ethyl]urea.
| Compound Name | 3-(3-chloro-4-fluorophenyl)-1-[4-[(2Z,4E)-5-cyano-6-methylhepta-2,4-dienyl]cyclohexyl]-1-[2-[(3S)-3-hydroxypyrrolidin-1-yl]ethyl]urea |
|---|---|
| PubChem CID | 142251214 |
| Molecular Formula | C28H38ClFN4O2 |
| Molecular Weight | 517.09 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | 3-(3-chloro-4-fluorophenyl)-1-[4-[(2Z,4E)-5-cyano-6-methylhepta-2,4-dienyl]cyclohexyl]-1-[2-[(3S)-3-hydroxypyrrolidin-1-yl]ethyl]urea |
| SMILES | CC(C)/C(C#N)=C\C=C/CC1CCC(N(CCN2CC[C@H](O)C2)C(=O)Nc2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C28H38ClFN4O2/c1-20(2)22(18-31)6-4-3-5-21-7-10-24(11-8-21)34(16-15-33-14-13-25(35)19-33)28(36)32-23-9-12-27(30)26(29)17-23/h3-4,6,9,12,17,20-21,24-25,35H,5,7-8,10-11,13-16,19H2,1-2H3,(H,32,36)/b4-3-,22-6-/t21?,24?,25-/m0/s1 |
| InChIKey | TUHLJGXHLYCFLO-HHCFASOZSA-N |
| XLogP | 5.99 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.09 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|