C30H33F2N3O — CID 142251249
2-[(3R,6R)-6-(3-cyanophenyl)-3-bicyclo[4.1.0]heptanyl]-N-(3,4-difluorophenyl)-6-pyrrolidin-1-ylhex-2-enamide (PubChem CID 142251249) has the molecular formula C30H33F2N3O and a molecular weight of 489.61 g/mol. Its IUPAC name is 2-[(3R,6R)-6-(3-cyanophenyl)-3-bicyclo[4.1.0]heptanyl]-N-(3,4-difluorophenyl)-6-pyrrolidin-1-ylhex-2-enamide.
| Compound Name | 2-[(3R,6R)-6-(3-cyanophenyl)-3-bicyclo[4.1.0]heptanyl]-N-(3,4-difluorophenyl)-6-pyrrolidin-1-ylhex-2-enamide |
|---|---|
| PubChem CID | 142251249 |
| Molecular Formula | C30H33F2N3O |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | 2-[(3R,6R)-6-(3-cyanophenyl)-3-bicyclo[4.1.0]heptanyl]-N-(3,4-difluorophenyl)-6-pyrrolidin-1-ylhex-2-enamide |
| SMILES | N#Cc1cccc([C@@]23CC[C@@H](C(=CCCCN4CCCC4)C(=O)Nc4ccc(F)c(F)c4)CC2C3)c1 |
| InChI | InChI=1S/C30H33F2N3O/c31-27-10-9-25(18-28(27)32)34-29(36)26(8-1-2-13-35-14-3-4-15-35)22-11-12-30(19-24(30)17-22)23-7-5-6-21(16-23)20-33/h5-10,16,18,22,24H,1-4,11-15,17,19H2,(H,34,36)/t22-,24?,30+/m1/s1 |
| InChIKey | ZVIYTHYBWBWHPD-CEEDCOSWSA-N |
| XLogP | 6.34 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|