C7H4F12 — CID 14225156
1,1,1,2,2,3,5,5,5-nonafluoro-3-methyl-4-(trifluoromethyl)pentane (PubChem CID 14225156) has the molecular formula C7H4F12 and a molecular weight of 316.09 g/mol. Its IUPAC name is 1,1,1,2,2,3,5,5,5-nonafluoro-3-methyl-4-(trifluoromethyl)pentane.
| Compound Name | 1,1,1,2,2,3,5,5,5-nonafluoro-3-methyl-4-(trifluoromethyl)pentane |
|---|---|
| PubChem CID | 14225156 |
| Molecular Formula | C7H4F12 |
| Molecular Weight | 316.09 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 1,1,1,2,2,3,5,5,5-nonafluoro-3-methyl-4-(trifluoromethyl)pentane |
| SMILES | CC(F)(C(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H4F12/c1-3(8,6(15,16)7(17,18)19)2(4(9,10)11)5(12,13)14/h2H,1H3 |
| InChIKey | ZPOALZCYPGFXHX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.09 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|