C27H31ClN6S — CID 142252081
methyl 4-[6-chloro-9-[(2-methylimidazol-1-yl)methyl]-17-azatricyclo[9.6.0.03,8]heptadeca-1(11),3(8),4,6,9,13,16-heptaen-2-yl]piperazine-1-carboximidothioate (PubChem CID 142252081) has the molecular formula C27H31ClN6S and a molecular weight of 507.11 g/mol. Its IUPAC name is methyl 4-[6-chloro-9-[(2-methylimidazol-1-yl)methyl]-17-azatricyclo[9.6.0.03,8]heptadeca-1(11),3(8),4,6,9,13,16-heptaen-2-yl]piperazine-1-carboximidothioate.
| Compound Name | methyl 4-[6-chloro-9-[(2-methylimidazol-1-yl)methyl]-17-azatricyclo[9.6.0.03,8]heptadeca-1(11),3(8),4,6,9,13,16-heptaen-2-yl]piperazine-1-carboximidothioate |
|---|---|
| PubChem CID | 142252081 |
| Molecular Formula | C27H31ClN6S |
| Molecular Weight | 507.11 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | methyl 4-[6-chloro-9-[(2-methylimidazol-1-yl)methyl]-17-azatricyclo[9.6.0.03,8]heptadeca-1(11),3(8),4,6,9,13,16-heptaen-2-yl]piperazine-1-carboximidothioate |
| SMILES | [H]/N=C(\SC)N1CCN(C2C3=C(C=C(Cn4ccnc4C)c4cc(Cl)ccc42)CC=CC/C=N\3)CC1 |
| InChI | InChI=1S/C27H31ClN6S/c1-19-30-10-11-34(19)18-21-16-20-6-4-3-5-9-31-25(20)26(23-8-7-22(28)17-24(21)23)32-12-14-33(15-13-32)27(29)35-2/h3-4,7-11,16-17,26,29H,5-6,12-15,18H2,1-2H3/b4-3?,29-27-,31-9- |
| InChIKey | TZMXOKDYKBCNDK-INIPMPQASA-N |
| XLogP | 5.57 |
| TPSA | 60.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.11 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|