About 3-but-3-enyl-1,3-dimethylpiperidine
3-but-3-enyl-1,3-dimethylpiperidine (PubChem CID 14225211) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is 3-but-3-enyl-1,3-dimethylpiperidine.
Molecular Properties
| Compound Name | 3-but-3-enyl-1,3-dimethylpiperidine |
| PubChem CID | 14225211 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | 3-but-3-enyl-1,3-dimethylpiperidine |
| SMILES | C=CCCC1(C)CCCN(C)C1 |
| InChI | InChI=1S/C11H21N/c1-4-5-7-11(2)8-6-9-12(3)10-11/h4H,1,5-10H2,2-3H3 |
| InChIKey | MYORBJCBJRKDMR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-but-3-enyl-1,3-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-but-3-enyl-1,3-dimethylpiperidine?
The IUPAC name of 3-but-3-enyl-1,3-dimethylpiperidine (CID 14225211) is 3-but-3-enyl-1,3-dimethylpiperidine.
What is the SMILES notation for 3-but-3-enyl-1,3-dimethylpiperidine?
The canonical SMILES for 3-but-3-enyl-1,3-dimethylpiperidine is C=CCCC1(C)CCCN(C)C1.
What is the InChIKey of 3-but-3-enyl-1,3-dimethylpiperidine?
The InChIKey is MYORBJCBJRKDMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N/c1-4-5-7-11(2)8-6-9-12(3)10-11/h4H,1,5-10H2,2-3H3.
What are the key properties of 3-but-3-enyl-1,3-dimethylpiperidine?
3-but-3-enyl-1,3-dimethylpiperidine has a molecular weight of 167.30 g/mol, XLogP of 2.68, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-but-3-enyl-1,3-dimethylpiperidine is sourced from PubChem (CID 14225211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).