C20H40O3 — CID 142252414
ethane;(2E,6E)-2,5,6-trimethyl-8-(oxan-2-yloxy)octa-2,6-dien-1-ol (PubChem CID 142252414) has the molecular formula C20H40O3 and a molecular weight of 328.54 g/mol. Its IUPAC name is ethane;(2E,6E)-2,5,6-trimethyl-8-(oxan-2-yloxy)octa-2,6-dien-1-ol.
| Compound Name | ethane;(2E,6E)-2,5,6-trimethyl-8-(oxan-2-yloxy)octa-2,6-dien-1-ol |
|---|---|
| PubChem CID | 142252414 |
| Molecular Formula | C20H40O3 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.30 |
| IUPAC Name | ethane;(2E,6E)-2,5,6-trimethyl-8-(oxan-2-yloxy)octa-2,6-dien-1-ol |
| SMILES | C/C(=C\CC(C)/C(C)=C/COC1CCCCO1)CO.CC.CC |
| InChI | InChI=1S/C16H28O3.2C2H6/c1-13(12-17)7-8-14(2)15(3)9-11-19-16-6-4-5-10-18-16;2*1-2/h7,9,14,16-17H,4-6,8,10-12H2,1-3H3;2*1-2H3/b13-7+,15-9+;; |
| InChIKey | HFXUQMIRROMCLR-DCEOOUNXSA-N |
| XLogP | 5.49 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|