C24H35N3O — CID 142252487
N-ethyl-1-[6-methoxy-5-methyl-4-(2-methylphenyl)-2-pyridinyl]-N-propylpiperidin-4-amine (PubChem CID 142252487) has the molecular formula C24H35N3O and a molecular weight of 381.56 g/mol. Its IUPAC name is N-ethyl-1-[6-methoxy-5-methyl-4-(2-methylphenyl)-2-pyridinyl]-N-propylpiperidin-4-amine.
| Compound Name | N-ethyl-1-[6-methoxy-5-methyl-4-(2-methylphenyl)-2-pyridinyl]-N-propylpiperidin-4-amine |
|---|---|
| PubChem CID | 142252487 |
| Molecular Formula | C24H35N3O |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.28 |
| IUPAC Name | N-ethyl-1-[6-methoxy-5-methyl-4-(2-methylphenyl)-2-pyridinyl]-N-propylpiperidin-4-amine |
| SMILES | CCCN(CC)C1CCN(c2cc(-c3ccccc3C)c(C)c(OC)n2)CC1 |
| InChI | InChI=1S/C24H35N3O/c1-6-14-26(7-2)20-12-15-27(16-13-20)23-17-22(19(4)24(25-23)28-5)21-11-9-8-10-18(21)3/h8-11,17,20H,6-7,12-16H2,1-5H3 |
| InChIKey | JSFPXAAUTPOZLD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |