C22H45NO2S — CID 142253261
4-hydroxy-N-(3,5,7,7,8,8,9,9-octamethyl-5-sulfanyldecyl)butanamide (PubChem CID 142253261) has the molecular formula C22H45NO2S and a molecular weight of 387.67 g/mol. Its IUPAC name is 4-hydroxy-N-(3,5,7,7,8,8,9,9-octamethyl-5-sulfanyldecyl)butanamide.
| Compound Name | 4-hydroxy-N-(3,5,7,7,8,8,9,9-octamethyl-5-sulfanyldecyl)butanamide |
|---|---|
| PubChem CID | 142253261 |
| Molecular Formula | C22H45NO2S |
| Molecular Weight | 387.67 g/mol |
| Exact Mass | 387.32 |
| IUPAC Name | 4-hydroxy-N-(3,5,7,7,8,8,9,9-octamethyl-5-sulfanyldecyl)butanamide |
| SMILES | CC(CCNC(=O)CCCO)CC(C)(S)CC(C)(C)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H45NO2S/c1-17(12-13-23-18(25)11-10-14-24)15-22(9,26)16-20(5,6)21(7,8)19(2,3)4/h17,24,26H,10-16H2,1-9H3,(H,23,25) |
| InChIKey | TZKJUPXPYIUPLR-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.67 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|