C23H24Cl2N6 — CID 142253512
N-[2-[[2-(2,4-dichlorophenyl)-2,3-dihydro-1H-quinazolin-4-ylidene]amino]ethyl]-5-(methylaminomethyl)pyridin-2-amine (PubChem CID 142253512) has the molecular formula C23H24Cl2N6 and a molecular weight of 455.39 g/mol. Its IUPAC name is N-[2-[[2-(2,4-dichlorophenyl)-2,3-dihydro-1H-quinazolin-4-ylidene]amino]ethyl]-5-(methylaminomethyl)pyridin-2-amine.
| Compound Name | N-[2-[[2-(2,4-dichlorophenyl)-2,3-dihydro-1H-quinazolin-4-ylidene]amino]ethyl]-5-(methylaminomethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 142253512 |
| Molecular Formula | C23H24Cl2N6 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | N-[2-[[2-(2,4-dichlorophenyl)-2,3-dihydro-1H-quinazolin-4-ylidene]amino]ethyl]-5-(methylaminomethyl)pyridin-2-amine |
| SMILES | CNCc1ccc(NCC/N=C2/NC(c3ccc(Cl)cc3Cl)Nc3ccccc32)nc1 |
| InChI | InChI=1S/C23H24Cl2N6/c1-26-13-15-6-9-21(29-14-15)27-10-11-28-22-18-4-2-3-5-20(18)30-23(31-22)17-8-7-16(24)12-19(17)25/h2-9,12,14,23,26,30H,10-11,13H2,1H3,(H,27,29)(H,28,31) |
| InChIKey | JZZFHQUCAMXDGT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 73.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|