C29H46N2O4S2 — CID 142253581
N-[4-[butyl-(2,4,6-trimethylphenyl)sulfonylamino]butyl]-2,4,6-trimethyl-N-propylbenzenesulfonamide (PubChem CID 142253581) has the molecular formula C29H46N2O4S2 and a molecular weight of 550.83 g/mol. Its IUPAC name is N-[4-[butyl-(2,4,6-trimethylphenyl)sulfonylamino]butyl]-2,4,6-trimethyl-N-propylbenzenesulfonamide.
| Compound Name | N-[4-[butyl-(2,4,6-trimethylphenyl)sulfonylamino]butyl]-2,4,6-trimethyl-N-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 142253581 |
| Molecular Formula | C29H46N2O4S2 |
| Molecular Weight | 550.83 g/mol |
| Exact Mass | 550.29 |
| IUPAC Name | N-[4-[butyl-(2,4,6-trimethylphenyl)sulfonylamino]butyl]-2,4,6-trimethyl-N-propylbenzenesulfonamide |
| SMILES | CCCCN(CCCCN(CCC)S(=O)(=O)c1c(C)cc(C)cc1C)S(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C29H46N2O4S2/c1-9-11-15-31(37(34,35)29-26(7)20-23(4)21-27(29)8)17-13-12-16-30(14-10-2)36(32,33)28-24(5)18-22(3)19-25(28)6/h18-21H,9-17H2,1-8H3 |
| InChIKey | RKWJUWQVGBMQPZ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.83 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|