C19H28N2S — CID 142253619
1-[(3E,5Z)-octa-1,3,5-trien-4-yl]-3-[(Z,3E)-3-prop-2-enylidenehept-4-en-2-yl]thiourea (PubChem CID 142253619) has the molecular formula C19H28N2S and a molecular weight of 316.51 g/mol. Its IUPAC name is 1-[(3E,5Z)-octa-1,3,5-trien-4-yl]-3-[(Z,3E)-3-prop-2-enylidenehept-4-en-2-yl]thiourea.
| Compound Name | 1-[(3E,5Z)-octa-1,3,5-trien-4-yl]-3-[(Z,3E)-3-prop-2-enylidenehept-4-en-2-yl]thiourea |
|---|---|
| PubChem CID | 142253619 |
| Molecular Formula | C19H28N2S |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 1-[(3E,5Z)-octa-1,3,5-trien-4-yl]-3-[(Z,3E)-3-prop-2-enylidenehept-4-en-2-yl]thiourea |
| SMILES | C=C/C=C(\C=C/CC)NC(=S)NC(C)C(/C=C\CC)=C/C=C |
| InChI | InChI=1S/C19H28N2S/c1-6-10-14-17(12-8-3)16(5)20-19(22)21-18(13-9-4)15-11-7-2/h8-16H,3-4,6-7H2,1-2,5H3,(H2,20,21,22)/b14-10-,15-11-,17-12+,18-13+ |
| InChIKey | GNBDLTLHYQTUAS-AZTKMAQQSA-N |
| XLogP | 4.95 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|