About 1-(4-amino-2,3,5,6-tetrafluorophenyl)-2-bromoethanone
1-(4-amino-2,3,5,6-tetrafluorophenyl)-2-bromoethanone (PubChem CID 142253846) has the molecular formula C8H4BrF4NO
and a molecular weight of 286.02 g/mol. Its IUPAC name is 1-(4-amino-2,3,5,6-tetrafluorophenyl)-2-bromoethanone.
Molecular Properties
| Compound Name | 1-(4-amino-2,3,5,6-tetrafluorophenyl)-2-bromoethanone |
| PubChem CID | 142253846 |
| Molecular Formula | C8H4BrF4NO |
| Molecular Weight | 286.02 g/mol |
| Exact Mass | 284.94 |
| IUPAC Name | 1-(4-amino-2,3,5,6-tetrafluorophenyl)-2-bromoethanone |
| SMILES | Nc1c(F)c(F)c(C(=O)CBr)c(F)c1F |
| InChI | InChI=1S/C8H4BrF4NO/c9-1-2(15)3-4(10)6(12)8(14)7(13)5(3)11/h1,14H2 |
| InChIKey | VSHINUXSAXWUPJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.02 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-amino-2,3,5,6-tetrafluorophenyl)-2-bromoethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-amino-2,3,5,6-tetrafluorophenyl)-2-bromoethanone?
The IUPAC name of 1-(4-amino-2,3,5,6-tetrafluorophenyl)-2-bromoethanone (CID 142253846) is 1-(4-amino-2,3,5,6-tetrafluorophenyl)-2-bromoethanone.
What is the SMILES notation for 1-(4-amino-2,3,5,6-tetrafluorophenyl)-2-bromoethanone?
The canonical SMILES for 1-(4-amino-2,3,5,6-tetrafluorophenyl)-2-bromoethanone is Nc1c(F)c(F)c(C(=O)CBr)c(F)c1F.
What is the InChIKey of 1-(4-amino-2,3,5,6-tetrafluorophenyl)-2-bromoethanone?
The InChIKey is VSHINUXSAXWUPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4BrF4NO/c9-1-2(15)3-4(10)6(12)8(14)7(13)5(3)11/h1,14H2.
What are the key properties of 1-(4-amino-2,3,5,6-tetrafluorophenyl)-2-bromoethanone?
1-(4-amino-2,3,5,6-tetrafluorophenyl)-2-bromoethanone has a molecular weight of 286.02 g/mol, XLogP of 2.40, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-amino-2,3,5,6-tetrafluorophenyl)-2-bromoethanone is sourced from PubChem (CID 142253846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).