C26H19F2N3O2 — CID 142254318
cyclopentene;7,19-difluoro-13-methyl-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione (PubChem CID 142254318) has the molecular formula C26H19F2N3O2 and a molecular weight of 443.45 g/mol. Its IUPAC name is cyclopentene;7,19-difluoro-13-methyl-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione.
| Compound Name | cyclopentene;7,19-difluoro-13-methyl-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione |
|---|---|
| PubChem CID | 142254318 |
| Molecular Formula | C26H19F2N3O2 |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | cyclopentene;7,19-difluoro-13-methyl-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione |
| SMILES | C1=CCCC1.CN1C(=O)c2c(c3c4cc(F)ccc4[nH]c3c3[nH]c4ccc(F)cc4c23)C1=O |
| InChI | InChI=1S/C21H11F2N3O2.C5H8/c1-26-20(27)16-14-10-6-8(22)2-4-12(10)24-18(14)19-15(17(16)21(26)28)11-7-9(23)3-5-13(11)25-19;1-2-4-5-3-1/h2-7,24-25H,1H3;1-2H,3-5H2 |
| InChIKey | LYNZAGCVHGJGCW-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|