C26H26Cl2N2O3 — CID 142254350
4,5-bis(4-chlorophenyl)-2-[3-ethyl-5-(methoxymethyl)phenyl]-4,5-dihydro-1H-imidazole;formic acid (PubChem CID 142254350) has the molecular formula C26H26Cl2N2O3 and a molecular weight of 485.41 g/mol. Its IUPAC name is 4,5-bis(4-chlorophenyl)-2-[3-ethyl-5-(methoxymethyl)phenyl]-4,5-dihydro-1H-imidazole;formic acid.
| Compound Name | 4,5-bis(4-chlorophenyl)-2-[3-ethyl-5-(methoxymethyl)phenyl]-4,5-dihydro-1H-imidazole;formic acid |
|---|---|
| PubChem CID | 142254350 |
| Molecular Formula | C26H26Cl2N2O3 |
| Molecular Weight | 485.41 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | 4,5-bis(4-chlorophenyl)-2-[3-ethyl-5-(methoxymethyl)phenyl]-4,5-dihydro-1H-imidazole;formic acid |
| SMILES | CCc1cc(COC)cc(C2=NC(c3ccc(Cl)cc3)C(c3ccc(Cl)cc3)N2)c1.O=CO |
| InChI | InChI=1S/C25H24Cl2N2O.CH2O2/c1-3-16-12-17(15-30-2)14-20(13-16)25-28-23(18-4-8-21(26)9-5-18)24(29-25)19-6-10-22(27)11-7-19;2-1-3/h4-14,23-24H,3,15H2,1-2H3,(H,28,29);1H,(H,2,3) |
| InChIKey | IQSDRTYWVMCYCW-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.41 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|