C20H15N5O4S — CID 1422544
(7Z)-7-(5-methyl-2-oxo-1H-indol-3-ylidene)-3-(3-nitrophenyl)-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one (PubChem CID 1422544) has the molecular formula C20H15N5O4S and a molecular weight of 421.44 g/mol. Its IUPAC name is (7Z)-7-(5-methyl-2-oxo-1H-indol-3-ylidene)-3-(3-nitrophenyl)-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one.
| Compound Name | (7Z)-7-(5-methyl-2-oxo-1H-indol-3-ylidene)-3-(3-nitrophenyl)-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one |
|---|---|
| PubChem CID | 1422544 |
| Molecular Formula | C20H15N5O4S |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | (7Z)-7-(5-methyl-2-oxo-1H-indol-3-ylidene)-3-(3-nitrophenyl)-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one |
| SMILES | Cc1ccc2c(c1)/C(=c1/sc3n(c1=O)CN(c1cccc([N+](=O)[O-])c1)CN=3)C(=O)N2 |
| InChI | InChI=1S/C20H15N5O4S/c1-11-5-6-15-14(7-11)16(18(26)22-15)17-19(27)24-10-23(9-21-20(24)30-17)12-3-2-4-13(8-12)25(28)29/h2-8H,9-10H2,1H3,(H,22,26)/b17-16- |
| InChIKey | CQSRYXWDNJHDST-MSUUIHNZSA-N |
| XLogP | 1.33 |
| TPSA | 109.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|