About aniline;(3Z)-3-methylpenta-1,3-diene;hydrochloride
aniline;(3Z)-3-methylpenta-1,3-diene;hydrochloride (PubChem CID 142254688) has the molecular formula C12H18ClN
and a molecular weight of 211.74 g/mol. Its IUPAC name is aniline;(3Z)-3-methylpenta-1,3-diene;hydrochloride.
Molecular Properties
| Compound Name | aniline;(3Z)-3-methylpenta-1,3-diene;hydrochloride |
| PubChem CID | 142254688 |
| Molecular Formula | C12H18ClN |
| Molecular Weight | 211.74 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | aniline;(3Z)-3-methylpenta-1,3-diene;hydrochloride |
| SMILES | C=C/C(C)=C\C.Cl.Nc1ccccc1 |
| InChI | InChI=1S/C6H7N.C6H10.ClH/c7-6-4-2-1-3-5-6;1-4-6(3)5-2;/h1-5H,7H2;4-5H,1H2,2-3H3;1H/b;6-5-; |
| InChIKey | PGLPRDVFIRNDPZ-XRPAZMCKSA-N |
| XLogP | 3.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.74 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze aniline;(3Z)-3-methylpenta-1,3-diene;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;(3Z)-3-methylpenta-1,3-diene;hydrochloride?
The IUPAC name of aniline;(3Z)-3-methylpenta-1,3-diene;hydrochloride (CID 142254688) is aniline;(3Z)-3-methylpenta-1,3-diene;hydrochloride.
What is the SMILES notation for aniline;(3Z)-3-methylpenta-1,3-diene;hydrochloride?
The canonical SMILES for aniline;(3Z)-3-methylpenta-1,3-diene;hydrochloride is C=C/C(C)=C\C.Cl.Nc1ccccc1.
What is the InChIKey of aniline;(3Z)-3-methylpenta-1,3-diene;hydrochloride?
The InChIKey is PGLPRDVFIRNDPZ-XRPAZMCKSA-N. The full InChI is InChI=1S/C6H7N.C6H10.ClH/c7-6-4-2-1-3-5-6;1-4-6(3)5-2;/h1-5H,7H2;4-5H,1H2,2-3H3;1H/b;6-5-;.
What are the key properties of aniline;(3Z)-3-methylpenta-1,3-diene;hydrochloride?
aniline;(3Z)-3-methylpenta-1,3-diene;hydrochloride has a molecular weight of 211.74 g/mol, XLogP of 3.83, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;(3Z)-3-methylpenta-1,3-diene;hydrochloride is sourced from PubChem (CID 142254688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).