About 2-cyclopenta-1,4-dien-1-yl-4-methyl-1,3-thiazole;methoxymethane
2-cyclopenta-1,4-dien-1-yl-4-methyl-1,3-thiazole;methoxymethane (PubChem CID 142254692) has the molecular formula C11H15NOS
and a molecular weight of 209.31 g/mol. Its IUPAC name is 2-cyclopenta-1,4-dien-1-yl-4-methyl-1,3-thiazole;methoxymethane.
Molecular Properties
| Compound Name | 2-cyclopenta-1,4-dien-1-yl-4-methyl-1,3-thiazole;methoxymethane |
| PubChem CID | 142254692 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 2-cyclopenta-1,4-dien-1-yl-4-methyl-1,3-thiazole;methoxymethane |
| SMILES | COC.Cc1csc(C2=CCC=C2)n1 |
| InChI | InChI=1S/C9H9NS.C2H6O/c1-7-6-11-9(10-7)8-4-2-3-5-8;1-3-2/h2,4-6H,3H2,1H3;1-2H3 |
| InChIKey | GBMSIUQHGXERAC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopenta-1,4-dien-1-yl-4-methyl-1,3-thiazole;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopenta-1,4-dien-1-yl-4-methyl-1,3-thiazole;methoxymethane?
The IUPAC name of 2-cyclopenta-1,4-dien-1-yl-4-methyl-1,3-thiazole;methoxymethane (CID 142254692) is 2-cyclopenta-1,4-dien-1-yl-4-methyl-1,3-thiazole;methoxymethane.
What is the SMILES notation for 2-cyclopenta-1,4-dien-1-yl-4-methyl-1,3-thiazole;methoxymethane?
The canonical SMILES for 2-cyclopenta-1,4-dien-1-yl-4-methyl-1,3-thiazole;methoxymethane is COC.Cc1csc(C2=CCC=C2)n1.
What is the InChIKey of 2-cyclopenta-1,4-dien-1-yl-4-methyl-1,3-thiazole;methoxymethane?
The InChIKey is GBMSIUQHGXERAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NS.C2H6O/c1-7-6-11-9(10-7)8-4-2-3-5-8;1-3-2/h2,4-6H,3H2,1H3;1-2H3.
What are the key properties of 2-cyclopenta-1,4-dien-1-yl-4-methyl-1,3-thiazole;methoxymethane?
2-cyclopenta-1,4-dien-1-yl-4-methyl-1,3-thiazole;methoxymethane has a molecular weight of 209.31 g/mol, XLogP of 3.06, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopenta-1,4-dien-1-yl-4-methyl-1,3-thiazole;methoxymethane is sourced from PubChem (CID 142254692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).