C10H23N3 — CID 142254760
N'-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]propane-1,3-diamine (PubChem CID 142254760) has the molecular formula C10H23N3 and a molecular weight of 185.31 g/mol. Its IUPAC name is N'-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]propane-1,3-diamine.
| Compound Name | N'-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 142254760 |
| Molecular Formula | C10H23N3 |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.19 |
| IUPAC Name | N'-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]propane-1,3-diamine |
| SMILES | CCN1CCC[C@H]1CNCCCN |
| InChI | InChI=1S/C10H23N3/c1-2-13-8-3-5-10(13)9-12-7-4-6-11/h10,12H,2-9,11H2,1H3/t10-/m0/s1 |
| InChIKey | QYEIMFWYUMKHND-JTQLQIEISA-N |
| XLogP | 0.41 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|