About N-(6-butan-2-yl-2-propan-2-yl-1-bicyclo[4.1.0]hepta-2,4-dienyl)propan-1-imine;propane
N-(6-butan-2-yl-2-propan-2-yl-1-bicyclo[4.1.0]hepta-2,4-dienyl)propan-1-imine;propane (PubChem CID 142255834) has the molecular formula C20H35N
and a molecular weight of 289.51 g/mol. Its IUPAC name is N-(6-butan-2-yl-2-propan-2-yl-1-bicyclo[4.1.0]hepta-2,4-dienyl)propan-1-imine;propane.
Molecular Properties
| Compound Name | N-(6-butan-2-yl-2-propan-2-yl-1-bicyclo[4.1.0]hepta-2,4-dienyl)propan-1-imine;propane |
| PubChem CID | 142255834 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | N-(6-butan-2-yl-2-propan-2-yl-1-bicyclo[4.1.0]hepta-2,4-dienyl)propan-1-imine;propane |
| SMILES | CC/C=N\C12CC1(C(C)CC)C=CC=C2C(C)C.CCC |
| InChI | InChI=1S/C17H27N.C3H8/c1-6-11-18-17-12-16(17,14(5)7-2)10-8-9-15(17)13(3)4;1-3-2/h8-11,13-14H,6-7,12H2,1-5H3;3H2,1-2H3/b18-11-; |
| InChIKey | QFGQCYBLIWGMSV-VVTVMFAVSA-N |
| XLogP | 6.21 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(6-butan-2-yl-2-propan-2-yl-1-bicyclo[4.1.0]hepta-2,4-dienyl)propan-1-imine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-butan-2-yl-2-propan-2-yl-1-bicyclo[4.1.0]hepta-2,4-dienyl)propan-1-imine;propane?
The IUPAC name of N-(6-butan-2-yl-2-propan-2-yl-1-bicyclo[4.1.0]hepta-2,4-dienyl)propan-1-imine;propane (CID 142255834) is N-(6-butan-2-yl-2-propan-2-yl-1-bicyclo[4.1.0]hepta-2,4-dienyl)propan-1-imine;propane.
What is the SMILES notation for N-(6-butan-2-yl-2-propan-2-yl-1-bicyclo[4.1.0]hepta-2,4-dienyl)propan-1-imine;propane?
The canonical SMILES for N-(6-butan-2-yl-2-propan-2-yl-1-bicyclo[4.1.0]hepta-2,4-dienyl)propan-1-imine;propane is CC/C=N\C12CC1(C(C)CC)C=CC=C2C(C)C.CCC.
What is the InChIKey of N-(6-butan-2-yl-2-propan-2-yl-1-bicyclo[4.1.0]hepta-2,4-dienyl)propan-1-imine;propane?
The InChIKey is QFGQCYBLIWGMSV-VVTVMFAVSA-N. The full InChI is InChI=1S/C17H27N.C3H8/c1-6-11-18-17-12-16(17,14(5)7-2)10-8-9-15(17)13(3)4;1-3-2/h8-11,13-14H,6-7,12H2,1-5H3;3H2,1-2H3/b18-11-;.
What are the key properties of N-(6-butan-2-yl-2-propan-2-yl-1-bicyclo[4.1.0]hepta-2,4-dienyl)propan-1-imine;propane?
N-(6-butan-2-yl-2-propan-2-yl-1-bicyclo[4.1.0]hepta-2,4-dienyl)propan-1-imine;propane has a molecular weight of 289.51 g/mol, XLogP of 6.21, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-butan-2-yl-2-propan-2-yl-1-bicyclo[4.1.0]hepta-2,4-dienyl)propan-1-imine;propane is sourced from PubChem (CID 142255834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).