C22H27N7O — CID 142255879
ethanimine;4-(5-ethyl-1H-pyrazol-4-yl)-N-[(2E,5E)-5-(1,3-oxazol-5-yl)octa-2,5,7-trien-2-yl]pyrimidin-2-amine (PubChem CID 142255879) has the molecular formula C22H27N7O and a molecular weight of 405.51 g/mol. Its IUPAC name is ethanimine;4-(5-ethyl-1H-pyrazol-4-yl)-N-[(2E,5E)-5-(1,3-oxazol-5-yl)octa-2,5,7-trien-2-yl]pyrimidin-2-amine.
| Compound Name | ethanimine;4-(5-ethyl-1H-pyrazol-4-yl)-N-[(2E,5E)-5-(1,3-oxazol-5-yl)octa-2,5,7-trien-2-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 142255879 |
| Molecular Formula | C22H27N7O |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | ethanimine;4-(5-ethyl-1H-pyrazol-4-yl)-N-[(2E,5E)-5-(1,3-oxazol-5-yl)octa-2,5,7-trien-2-yl]pyrimidin-2-amine |
| SMILES | C=C/C=C(\C/C=C(\C)Nc1nccc(-c2cn[nH]c2CC)n1)c1cnco1.[H]/N=C/C |
| InChI | InChI=1S/C20H22N6O.C2H5N/c1-4-6-15(19-12-21-13-27-19)8-7-14(3)24-20-22-10-9-18(25-20)16-11-23-26-17(16)5-2;1-2-3/h4,6-7,9-13H,1,5,8H2,2-3H3,(H,23,26)(H,22,24,25);2-3H,1H3/b14-7+,15-6+;3-2+ |
| InChIKey | LGKGEEHUTAKRIS-JMEBVUKWSA-N |
| XLogP | 5.05 |
| TPSA | 116.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|