C10H12O4 — CID 142256101
(3aS,4R,7aS)-4-hydroxy-3a,7a-dimethyl-4,7-dihydro-2-benzofuran-1,3-dione (PubChem CID 142256101) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is (3aS,4R,7aS)-4-hydroxy-3a,7a-dimethyl-4,7-dihydro-2-benzofuran-1,3-dione.
| Compound Name | (3aS,4R,7aS)-4-hydroxy-3a,7a-dimethyl-4,7-dihydro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 142256101 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (3aS,4R,7aS)-4-hydroxy-3a,7a-dimethyl-4,7-dihydro-2-benzofuran-1,3-dione |
| SMILES | C[C@]12CC=C[C@@H](O)[C@@]1(C)C(=O)OC2=O |
| InChI | InChI=1S/C10H12O4/c1-9-5-3-4-6(11)10(9,2)8(13)14-7(9)12/h3-4,6,11H,5H2,1-2H3/t6-,9-,10+/m1/s1 |
| InChIKey | VEGCWJJDNWLXEG-DRTBCBBWSA-N |
| XLogP | 0.40 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|