C16H28N2 — CID 142256444
N-ethyl-1-[(3E,5Z)-3-methylocta-3,5,7-trienyl]piperidin-4-amine (PubChem CID 142256444) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is N-ethyl-1-[(3E,5Z)-3-methylocta-3,5,7-trienyl]piperidin-4-amine.
| Compound Name | N-ethyl-1-[(3E,5Z)-3-methylocta-3,5,7-trienyl]piperidin-4-amine |
|---|---|
| PubChem CID | 142256444 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | N-ethyl-1-[(3E,5Z)-3-methylocta-3,5,7-trienyl]piperidin-4-amine |
| SMILES | C=C/C=C\C=C(/C)CCN1CCC(NCC)CC1 |
| InChI | InChI=1S/C16H28N2/c1-4-6-7-8-15(3)9-12-18-13-10-16(11-14-18)17-5-2/h4,6-8,16-17H,1,5,9-14H2,2-3H3/b7-6-,15-8+ |
| InChIKey | KXDXSZJYCKXUTO-WLYYOSHGSA-N |
| XLogP | 3.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|