About 1-cyclohepta-1,4,6-trien-1-yl-N-ethylethanamine
1-cyclohepta-1,4,6-trien-1-yl-N-ethylethanamine (PubChem CID 142256460) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is 1-cyclohepta-1,4,6-trien-1-yl-N-ethylethanamine.
Molecular Properties
| Compound Name | 1-cyclohepta-1,4,6-trien-1-yl-N-ethylethanamine |
| PubChem CID | 142256460 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 1-cyclohepta-1,4,6-trien-1-yl-N-ethylethanamine |
| SMILES | CCNC(C)C1=CCC=CC=C1 |
| InChI | InChI=1S/C11H17N/c1-3-12-10(2)11-8-6-4-5-7-9-11/h4-6,8-10,12H,3,7H2,1-2H3 |
| InChIKey | BUKHPAIITGXLIU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclohepta-1,4,6-trien-1-yl-N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohepta-1,4,6-trien-1-yl-N-ethylethanamine?
The IUPAC name of 1-cyclohepta-1,4,6-trien-1-yl-N-ethylethanamine (CID 142256460) is 1-cyclohepta-1,4,6-trien-1-yl-N-ethylethanamine.
What is the SMILES notation for 1-cyclohepta-1,4,6-trien-1-yl-N-ethylethanamine?
The canonical SMILES for 1-cyclohepta-1,4,6-trien-1-yl-N-ethylethanamine is CCNC(C)C1=CCC=CC=C1.
What is the InChIKey of 1-cyclohepta-1,4,6-trien-1-yl-N-ethylethanamine?
The InChIKey is BUKHPAIITGXLIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N/c1-3-12-10(2)11-8-6-4-5-7-9-11/h4-6,8-10,12H,3,7H2,1-2H3.
What are the key properties of 1-cyclohepta-1,4,6-trien-1-yl-N-ethylethanamine?
1-cyclohepta-1,4,6-trien-1-yl-N-ethylethanamine has a molecular weight of 163.26 g/mol, XLogP of 2.43, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohepta-1,4,6-trien-1-yl-N-ethylethanamine is sourced from PubChem (CID 142256460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).