C28H34F3N5O2S — CID 142257357
1-[3-[[1-hydroxy-5-[4-phenyl-5-[[4-(trifluoromethyl)phenyl]methylsulfanyl]-1,2,4-triazol-3-yl]pentyl]amino]propyl]pyrrolidin-2-one (PubChem CID 142257357) has the molecular formula C28H34F3N5O2S and a molecular weight of 561.67 g/mol. Its IUPAC name is 1-[3-[[1-hydroxy-5-[4-phenyl-5-[[4-(trifluoromethyl)phenyl]methylsulfanyl]-1,2,4-triazol-3-yl]pentyl]amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[1-hydroxy-5-[4-phenyl-5-[[4-(trifluoromethyl)phenyl]methylsulfanyl]-1,2,4-triazol-3-yl]pentyl]amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 142257357 |
| Molecular Formula | C28H34F3N5O2S |
| Molecular Weight | 561.67 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | 1-[3-[[1-hydroxy-5-[4-phenyl-5-[[4-(trifluoromethyl)phenyl]methylsulfanyl]-1,2,4-triazol-3-yl]pentyl]amino]propyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCCNC(O)CCCCc1nnc(SCc2ccc(C(F)(F)F)cc2)n1-c1ccccc1 |
| InChI | InChI=1S/C28H34F3N5O2S/c29-28(30,31)22-15-13-21(14-16-22)20-39-27-34-33-24(36(27)23-8-2-1-3-9-23)10-4-5-11-25(37)32-17-7-19-35-18-6-12-26(35)38/h1-3,8-9,13-16,25,32,37H,4-7,10-12,17-20H2 |
| InChIKey | SUFQWLOEWBEGHY-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.67 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|