C25H25FN4O3S — CID 142257529
2-(aminomethyl)phenol;2-[5-[(3-fluorophenyl)methylsulfanyl]-4-(3-methoxyphenyl)-1,2,4-triazol-3-yl]acetaldehyde (PubChem CID 142257529) has the molecular formula C25H25FN4O3S and a molecular weight of 480.57 g/mol. Its IUPAC name is 2-(aminomethyl)phenol;2-[5-[(3-fluorophenyl)methylsulfanyl]-4-(3-methoxyphenyl)-1,2,4-triazol-3-yl]acetaldehyde.
| Compound Name | 2-(aminomethyl)phenol;2-[5-[(3-fluorophenyl)methylsulfanyl]-4-(3-methoxyphenyl)-1,2,4-triazol-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 142257529 |
| Molecular Formula | C25H25FN4O3S |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | 2-(aminomethyl)phenol;2-[5-[(3-fluorophenyl)methylsulfanyl]-4-(3-methoxyphenyl)-1,2,4-triazol-3-yl]acetaldehyde |
| SMILES | COc1cccc(-n2c(CC=O)nnc2SCc2cccc(F)c2)c1.NCc1ccccc1O |
| InChI | InChI=1S/C18H16FN3O2S.C7H9NO/c1-24-16-7-3-6-15(11-16)22-17(8-9-23)20-21-18(22)25-12-13-4-2-5-14(19)10-13;8-5-6-3-1-2-4-7(6)9/h2-7,9-11H,8,12H2,1H3;1-4,9H,5,8H2 |
| InChIKey | JZCVXYMZAQZZQG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|