C14H23N — CID 142257733
(3Z,5Z)-N-butyl-3-ethynyl-N-methylhepta-3,5-dien-1-amine (PubChem CID 142257733) has the molecular formula C14H23N and a molecular weight of 205.35 g/mol. Its IUPAC name is (3Z,5Z)-N-butyl-3-ethynyl-N-methylhepta-3,5-dien-1-amine.
| Compound Name | (3Z,5Z)-N-butyl-3-ethynyl-N-methylhepta-3,5-dien-1-amine |
|---|---|
| PubChem CID | 142257733 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.35 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | (3Z,5Z)-N-butyl-3-ethynyl-N-methylhepta-3,5-dien-1-amine |
| SMILES | C#C/C(=C\C=C/C)CCN(C)CCCC |
| InChI | InChI=1S/C14H23N/c1-5-8-10-14(7-3)11-13-15(4)12-9-6-2/h3,5,8,10H,6,9,11-13H2,1-2,4H3/b8-5-,14-10+ |
| InChIKey | WSIQVCOCBGOELZ-IOBBEBRSSA-N |
| XLogP | 3.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|