C13H23NO — CID 142258153
N-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxyethyl]butan-1-amine (PubChem CID 142258153) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is N-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxyethyl]butan-1-amine.
| Compound Name | N-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxyethyl]butan-1-amine |
|---|---|
| PubChem CID | 142258153 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | N-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxyethyl]butan-1-amine |
| SMILES | C=C/C=C(\C=C/C)OCCNCCCC |
| InChI | InChI=1S/C13H23NO/c1-4-7-10-14-11-12-15-13(8-5-2)9-6-3/h5-6,8-9,14H,2,4,7,10-12H2,1,3H3/b9-6-,13-8+ |
| InChIKey | TUIACXYDTSKKBG-CMLKFSTMSA-N |
| XLogP | 3.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|