C16H22NO+ — CID 142258321
[(6Z)-6-[(2E,4E,5Z)-4-ethylidenehepta-2,5-dienylidene]-3-methoxycyclohex-2-en-1-ylidene]azanium (PubChem CID 142258321) has the molecular formula C16H22NO+ and a molecular weight of 244.36 g/mol. Its IUPAC name is [(6Z)-6-[(2E,4E,5Z)-4-ethylidenehepta-2,5-dienylidene]-3-methoxycyclohex-2-en-1-ylidene]azanium.
| Compound Name | [(6Z)-6-[(2E,4E,5Z)-4-ethylidenehepta-2,5-dienylidene]-3-methoxycyclohex-2-en-1-ylidene]azanium |
|---|---|
| PubChem CID | 142258321 |
| Molecular Formula | C16H22NO+ |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | [(6Z)-6-[(2E,4E,5Z)-4-ethylidenehepta-2,5-dienylidene]-3-methoxycyclohex-2-en-1-ylidene]azanium |
| SMILES | C/C=C\C(\C=C\C=C1\CCC(OC)=CC1=[NH2+])=C/C |
| InChI | InChI=1S/C16H21NO/c1-4-7-13(5-2)8-6-9-14-10-11-15(18-3)12-16(14)17/h4-9,12,17H,10-11H2,1-3H3/p+1/b7-4-,8-6+,13-5+,14-9-,17-16? |
| InChIKey | PJMZNKXGIRKZEM-RQZRKMHUSA-O |
| XLogP | 2.52 |
| TPSA | 34.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|