About (Z)-1-ethylsulfanyl-N,3-dimethylbut-1-en-2-amine;propane
(Z)-1-ethylsulfanyl-N,3-dimethylbut-1-en-2-amine;propane (PubChem CID 142258357) has the molecular formula C11H25NS
and a molecular weight of 203.39 g/mol. Its IUPAC name is (Z)-1-ethylsulfanyl-N,3-dimethylbut-1-en-2-amine;propane.
Molecular Properties
| Compound Name | (Z)-1-ethylsulfanyl-N,3-dimethylbut-1-en-2-amine;propane |
| PubChem CID | 142258357 |
| Molecular Formula | C11H25NS |
| Molecular Weight | 203.39 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | (Z)-1-ethylsulfanyl-N,3-dimethylbut-1-en-2-amine;propane |
| SMILES | CCC.CCS/C=C(\NC)C(C)C |
| InChI | InChI=1S/C8H17NS.C3H8/c1-5-10-6-8(9-4)7(2)3;1-3-2/h6-7,9H,5H2,1-4H3;3H2,1-2H3/b8-6-; |
| InChIKey | UHSOKOQMTUTLRU-PHZXCRFESA-N |
| XLogP | 3.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-1-ethylsulfanyl-N,3-dimethylbut-1-en-2-amine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-ethylsulfanyl-N,3-dimethylbut-1-en-2-amine;propane?
The IUPAC name of (Z)-1-ethylsulfanyl-N,3-dimethylbut-1-en-2-amine;propane (CID 142258357) is (Z)-1-ethylsulfanyl-N,3-dimethylbut-1-en-2-amine;propane.
What is the SMILES notation for (Z)-1-ethylsulfanyl-N,3-dimethylbut-1-en-2-amine;propane?
The canonical SMILES for (Z)-1-ethylsulfanyl-N,3-dimethylbut-1-en-2-amine;propane is CCC.CCS/C=C(\NC)C(C)C.
What is the InChIKey of (Z)-1-ethylsulfanyl-N,3-dimethylbut-1-en-2-amine;propane?
The InChIKey is UHSOKOQMTUTLRU-PHZXCRFESA-N. The full InChI is InChI=1S/C8H17NS.C3H8/c1-5-10-6-8(9-4)7(2)3;1-3-2/h6-7,9H,5H2,1-4H3;3H2,1-2H3/b8-6-;.
What are the key properties of (Z)-1-ethylsulfanyl-N,3-dimethylbut-1-en-2-amine;propane?
(Z)-1-ethylsulfanyl-N,3-dimethylbut-1-en-2-amine;propane has a molecular weight of 203.39 g/mol, XLogP of 3.87, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-ethylsulfanyl-N,3-dimethylbut-1-en-2-amine;propane is sourced from PubChem (CID 142258357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).