About N-[(Z)-2,7-dimethyloct-3-en-3-yl]methanimine;ethane
N-[(Z)-2,7-dimethyloct-3-en-3-yl]methanimine;ethane (PubChem CID 142258401) has the molecular formula C13H27N
and a molecular weight of 197.37 g/mol. Its IUPAC name is N-[(Z)-2,7-dimethyloct-3-en-3-yl]methanimine;ethane.
Molecular Properties
| Compound Name | N-[(Z)-2,7-dimethyloct-3-en-3-yl]methanimine;ethane |
| PubChem CID | 142258401 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | N-[(Z)-2,7-dimethyloct-3-en-3-yl]methanimine;ethane |
| SMILES | C=N/C(=C\CCC(C)C)C(C)C.CC |
| InChI | InChI=1S/C11H21N.C2H6/c1-9(2)7-6-8-11(12-5)10(3)4;1-2/h8-10H,5-7H2,1-4H3;1-2H3/b11-8-; |
| InChIKey | KEKIDZQZDZPEQU-MKFZHGHUSA-N |
| XLogP | 4.69 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-2,7-dimethyloct-3-en-3-yl]methanimine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-2,7-dimethyloct-3-en-3-yl]methanimine;ethane?
The IUPAC name of N-[(Z)-2,7-dimethyloct-3-en-3-yl]methanimine;ethane (CID 142258401) is N-[(Z)-2,7-dimethyloct-3-en-3-yl]methanimine;ethane.
What is the SMILES notation for N-[(Z)-2,7-dimethyloct-3-en-3-yl]methanimine;ethane?
The canonical SMILES for N-[(Z)-2,7-dimethyloct-3-en-3-yl]methanimine;ethane is C=N/C(=C\CCC(C)C)C(C)C.CC.
What is the InChIKey of N-[(Z)-2,7-dimethyloct-3-en-3-yl]methanimine;ethane?
The InChIKey is KEKIDZQZDZPEQU-MKFZHGHUSA-N. The full InChI is InChI=1S/C11H21N.C2H6/c1-9(2)7-6-8-11(12-5)10(3)4;1-2/h8-10H,5-7H2,1-4H3;1-2H3/b11-8-;.
What are the key properties of N-[(Z)-2,7-dimethyloct-3-en-3-yl]methanimine;ethane?
N-[(Z)-2,7-dimethyloct-3-en-3-yl]methanimine;ethane has a molecular weight of 197.37 g/mol, XLogP of 4.69, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-2,7-dimethyloct-3-en-3-yl]methanimine;ethane is sourced from PubChem (CID 142258401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).