About 2-nitrosoadamantane
2-nitrosoadamantane (PubChem CID 14225850) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is 2-nitrosoadamantane.
Molecular Properties
| Compound Name | 2-nitrosoadamantane |
| PubChem CID | 14225850 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 2-nitrosoadamantane |
| SMILES | O=NC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C10H15NO/c12-11-10-8-2-6-1-7(4-8)5-9(10)3-6/h6-10H,1-5H2 |
| InChIKey | NNPWCJCKHBRWGF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-nitrosoadamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitrosoadamantane?
The IUPAC name of 2-nitrosoadamantane (CID 14225850) is 2-nitrosoadamantane.
What is the SMILES notation for 2-nitrosoadamantane?
The canonical SMILES for 2-nitrosoadamantane is O=NC1C2CC3CC(C2)CC1C3.
What is the InChIKey of 2-nitrosoadamantane?
The InChIKey is NNPWCJCKHBRWGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c12-11-10-8-2-6-1-7(4-8)5-9(10)3-6/h6-10H,1-5H2.
What are the key properties of 2-nitrosoadamantane?
2-nitrosoadamantane has a molecular weight of 165.24 g/mol, XLogP of 2.58, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitrosoadamantane is sourced from PubChem (CID 14225850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).