C31H43NO4 — CID 142258779
ethane;4-[[4-[[(1R,2S)-1-(methoxymethyl)-2-[(2-methylpropan-2-yl)oxymethoxymethyl]cyclopropyl]methyl]phenoxy]methyl]-2-methylquinoline (PubChem CID 142258779) has the molecular formula C31H43NO4 and a molecular weight of 493.69 g/mol. Its IUPAC name is ethane;4-[[4-[[(1R,2S)-1-(methoxymethyl)-2-[(2-methylpropan-2-yl)oxymethoxymethyl]cyclopropyl]methyl]phenoxy]methyl]-2-methylquinoline.
| Compound Name | ethane;4-[[4-[[(1R,2S)-1-(methoxymethyl)-2-[(2-methylpropan-2-yl)oxymethoxymethyl]cyclopropyl]methyl]phenoxy]methyl]-2-methylquinoline |
|---|---|
| PubChem CID | 142258779 |
| Molecular Formula | C31H43NO4 |
| Molecular Weight | 493.69 g/mol |
| Exact Mass | 493.32 |
| IUPAC Name | ethane;4-[[4-[[(1R,2S)-1-(methoxymethyl)-2-[(2-methylpropan-2-yl)oxymethoxymethyl]cyclopropyl]methyl]phenoxy]methyl]-2-methylquinoline |
| SMILES | CC.COC[C@@]1(Cc2ccc(OCc3cc(C)nc4ccccc34)cc2)C[C@@H]1COCOC(C)(C)C |
| InChI | InChI=1S/C29H37NO4.C2H6/c1-21-14-23(26-8-6-7-9-27(26)30-21)17-33-25-12-10-22(11-13-25)15-29(19-31-5)16-24(29)18-32-20-34-28(2,3)4;1-2/h6-14,24H,15-20H2,1-5H3;1-2H3/t24-,29-;/m1./s1 |
| InChIKey | BFUFVXGDXKAFIZ-VOPILSCNSA-N |
| XLogP | 7.13 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.69 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|