C17H29NO2 — CID 142259012
4-[2-[(2Z,4Z)-4-(2-methylpropyl)hepta-2,4,6-trienoxy]ethyl]morpholine (PubChem CID 142259012) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is 4-[2-[(2Z,4Z)-4-(2-methylpropyl)hepta-2,4,6-trienoxy]ethyl]morpholine.
| Compound Name | 4-[2-[(2Z,4Z)-4-(2-methylpropyl)hepta-2,4,6-trienoxy]ethyl]morpholine |
|---|---|
| PubChem CID | 142259012 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 4-[2-[(2Z,4Z)-4-(2-methylpropyl)hepta-2,4,6-trienoxy]ethyl]morpholine |
| SMILES | C=C/C=C(\C=C/COCCN1CCOCC1)CC(C)C |
| InChI | InChI=1S/C17H29NO2/c1-4-6-17(15-16(2)3)7-5-11-19-12-8-18-9-13-20-14-10-18/h4-7,16H,1,8-15H2,2-3H3/b7-5-,17-6+ |
| InChIKey | CQRREBGFNJNSRQ-APZVSDDJSA-N |
| XLogP | 3.05 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|