C14H25N — CID 142259013
(5Z)-2-ethenyl-N,N-dimethylhepta-2,3,5-trien-1-amine;propane (PubChem CID 142259013) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is (5Z)-2-ethenyl-N,N-dimethylhepta-2,3,5-trien-1-amine;propane.
| Compound Name | (5Z)-2-ethenyl-N,N-dimethylhepta-2,3,5-trien-1-amine;propane |
|---|---|
| PubChem CID | 142259013 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | (5Z)-2-ethenyl-N,N-dimethylhepta-2,3,5-trien-1-amine;propane |
| SMILES | C=CC(=C=C/C=C\C)CN(C)C.CCC |
| InChI | InChI=1S/C11H17N.C3H8/c1-5-7-8-9-11(6-2)10-12(3)4;1-3-2/h5-8H,2,10H2,1,3-4H3;3H2,1-2H3/b7-5-; |
| InChIKey | HEBMJZMRDCZJDY-YJOCEBFMSA-N |
| XLogP | 3.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|