C17H29FN2O — CID 142259030
1-[2-[(2Z,4Z,6Z)-6-ethyl-2-fluoroocta-2,4,6-trien-3-yl]oxyethyl]-4-methylpiperazine (PubChem CID 142259030) has the molecular formula C17H29FN2O and a molecular weight of 296.43 g/mol. Its IUPAC name is 1-[2-[(2Z,4Z,6Z)-6-ethyl-2-fluoroocta-2,4,6-trien-3-yl]oxyethyl]-4-methylpiperazine.
| Compound Name | 1-[2-[(2Z,4Z,6Z)-6-ethyl-2-fluoroocta-2,4,6-trien-3-yl]oxyethyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 142259030 |
| Molecular Formula | C17H29FN2O |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | 1-[2-[(2Z,4Z,6Z)-6-ethyl-2-fluoroocta-2,4,6-trien-3-yl]oxyethyl]-4-methylpiperazine |
| SMILES | C/C=C(\C=C/C(OCCN1CCN(C)CC1)=C(\C)F)CC |
| InChI | InChI=1S/C17H29FN2O/c1-5-16(6-2)7-8-17(15(3)18)21-14-13-20-11-9-19(4)10-12-20/h5,7-8H,6,9-14H2,1-4H3/b8-7-,16-5-,17-15- |
| InChIKey | AAZUCZZGKMJGKR-PGDKEVCSSA-N |
| XLogP | 3.36 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|