About (3Z)-3,4-difluoro-2-methylidenehexa-3,5-diene-1-thiol
(3Z)-3,4-difluoro-2-methylidenehexa-3,5-diene-1-thiol (PubChem CID 142259058) has the molecular formula C7H8F2S
and a molecular weight of 162.20 g/mol. Its IUPAC name is (3Z)-3,4-difluoro-2-methylidenehexa-3,5-diene-1-thiol.
Molecular Properties
| Compound Name | (3Z)-3,4-difluoro-2-methylidenehexa-3,5-diene-1-thiol |
| PubChem CID | 142259058 |
| Molecular Formula | C7H8F2S |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.03 |
| IUPAC Name | (3Z)-3,4-difluoro-2-methylidenehexa-3,5-diene-1-thiol |
| SMILES | C=C/C(F)=C(/F)C(=C)CS |
| InChI | InChI=1S/C7H8F2S/c1-3-6(8)7(9)5(2)4-10/h3,10H,1-2,4H2/b7-6- |
| InChIKey | UKKVKHOOZPZNFJ-SREVYHEPSA-N |
| XLogP | 2.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3,4-difluoro-2-methylidenehexa-3,5-diene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3,4-difluoro-2-methylidenehexa-3,5-diene-1-thiol?
The IUPAC name of (3Z)-3,4-difluoro-2-methylidenehexa-3,5-diene-1-thiol (CID 142259058) is (3Z)-3,4-difluoro-2-methylidenehexa-3,5-diene-1-thiol.
What is the SMILES notation for (3Z)-3,4-difluoro-2-methylidenehexa-3,5-diene-1-thiol?
The canonical SMILES for (3Z)-3,4-difluoro-2-methylidenehexa-3,5-diene-1-thiol is C=C/C(F)=C(/F)C(=C)CS.
What is the InChIKey of (3Z)-3,4-difluoro-2-methylidenehexa-3,5-diene-1-thiol?
The InChIKey is UKKVKHOOZPZNFJ-SREVYHEPSA-N. The full InChI is InChI=1S/C7H8F2S/c1-3-6(8)7(9)5(2)4-10/h3,10H,1-2,4H2/b7-6-.
What are the key properties of (3Z)-3,4-difluoro-2-methylidenehexa-3,5-diene-1-thiol?
(3Z)-3,4-difluoro-2-methylidenehexa-3,5-diene-1-thiol has a molecular weight of 162.20 g/mol, XLogP of 2.81, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3,4-difluoro-2-methylidenehexa-3,5-diene-1-thiol is sourced from PubChem (CID 142259058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).