C29H32N6O3 — CID 142259185
N-[2-[[6-[4-methoxy-4-(2-methylphenyl)piperidine-1-carbonyl]-2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]formamide (PubChem CID 142259185) has the molecular formula C29H32N6O3 and a molecular weight of 512.61 g/mol. Its IUPAC name is N-[2-[[6-[4-methoxy-4-(2-methylphenyl)piperidine-1-carbonyl]-2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]formamide.
| Compound Name | N-[2-[[6-[4-methoxy-4-(2-methylphenyl)piperidine-1-carbonyl]-2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]formamide |
|---|---|
| PubChem CID | 142259185 |
| Molecular Formula | C29H32N6O3 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | N-[2-[[6-[4-methoxy-4-(2-methylphenyl)piperidine-1-carbonyl]-2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]formamide |
| SMILES | COC1(c2ccccc2C)CCN(C(=O)c2cc3c(NCCNC=O)nc(-c4ccccc4)nc3[nH]2)CC1 |
| InChI | InChI=1S/C29H32N6O3/c1-20-8-6-7-11-23(20)29(38-2)12-16-35(17-13-29)28(37)24-18-22-26(31-15-14-30-19-36)33-25(34-27(22)32-24)21-9-4-3-5-10-21/h3-11,18-19H,12-17H2,1-2H3,(H,30,36)(H2,31,32,33,34) |
| InChIKey | CNCPPRWKGYFVPP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|